CAS 34457-01-7

1-(1-Bromoethyl)-2-methylbenzene

Description:

1-(1-Bromoethyl)-2-methylbenzene, also known as 1-bromo-2-methyl-1-phenylethane, is an organic compound characterized by its aromatic structure and the presence of a bromine atom attached to a branched alkyl group. This compound features a methyl group and a bromoethyl group attached to a benzene ring, which contributes to its reactivity and physical properties. It is typically a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the bromine atom makes it a halogenated compound, which can participate in various chemical reactions, such as nucleophilic substitution and elimination reactions. Its molecular structure allows for potential applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the bromine substituent and the methyl group, affecting its behavior in different chemical environments. Safety precautions should be taken when handling this compound due to the potential hazards associated with brominated organic compounds.

Formula: C₉H₁₁Br

InChI: InChI=1S/C9H11Br/c1-7-5-3-4-6-9(7)8(2)10/h3-6,8H,1-2H3

InChI key: InChIKey=LKNZNIHNBFZDQM-UHFFFAOYSA-N

SMILES: C(Br)(C)C1=C(C)C=CC=C1

Synonyms:

• 1-Bromoethyl-2-methylbenzene
• Benzene, 1-(1-bromoethyl)-2-methyl-
• 1-(1-Bromoethyl)-2-methylbenzene

1-(1-Bromoethyl)-2-methylbenzene

CAS: 34457-01-7

Versatile small molecule scaffold

Formula: C₉H₁₁Br

Purity: Min. 95%

Molecular weight: 199.09 g/mol

Ref: 3D-JBA45701