CymitQuimica logo

CAS 344578-06-9

:

ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate

Description:
Ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate, identified by its CAS number 344578-06-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a carbamate functional group, which is known for its applications in agriculture as a pesticide and herbicide. The compound contains multiple methoxy groups, which can enhance its solubility and reactivity. Additionally, the presence of a phosphoryl group suggests potential biological activity, possibly influencing its interaction with enzymes or receptors. The 3-methoxyphenyl moiety may contribute to the compound's hydrophobic characteristics, affecting its bioavailability and environmental persistence. Overall, this compound's unique structure may impart specific properties that are of interest in both synthetic chemistry and potential applications in agrochemicals or pharmaceuticals. However, detailed studies would be necessary to fully elucidate its behavior and efficacy in various contexts.
Formula:C17H28NO8P
InChI:InChI=1/C17H28NO8P/c1-7-26-17(19)18(12-15(22-3)23-4)16(27(20,24-5)25-6)13-9-8-10-14(11-13)21-2/h8-11,15-16H,7,12H2,1-6H3
SMILES:CCOC(=O)N(CC(OC)OC)C(c1cccc(c1)OC)P(=O)(OC)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.