CymitQuimica logo

CAS 344591-91-9

:

[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]boronic acid

Description:
[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyrazole ring, which contributes to its unique chemical reactivity and potential applications in medicinal chemistry and materials science. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it a valuable scaffold in drug design. The presence of the boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, a widely used method for forming carbon-carbon bonds in organic synthesis. Additionally, this compound may exhibit interesting properties such as fluorescence or catalytic activity, depending on its specific structure and substituents. Overall, [1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]boronic acid is a versatile compound with significant potential in various chemical applications.
Formula:C5H6BF3N2O2
InChI:InChI=1/C5H6BF3N2O2/c1-11-4(6(12)13)2-3(10-11)5(7,8)9/h2,12-13H,1H3
InChI key:XPUNXPPXMANQGF-UHFFFAOYSA-N
SMILES:Cn1c(cc(C(F)(F)F)n1)B(O)O
Synonyms:
  • 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid
  • 1-Methyl-3-trifluoromethylpyrazole-5-boronic Acid
  • 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)boronic acid
Found 5 products.