CAS 3446-04-6

4-bromo-5-methylbenzene-1,3-diol

Description:

4-Bromo-5-methylbenzene-1,3-diol, also known as 4-bromo-5-methylresorcinol, is an organic compound characterized by its aromatic structure featuring a bromine atom and a methyl group attached to a benzene ring, along with two hydroxyl (–OH) groups positioned at the 1 and 3 positions of the ring. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The bromine substituent can enhance the compound's reactivity, making it useful in synthetic organic chemistry. Additionally, the presence of multiple functional groups allows for further chemical modifications, which can lead to the development of derivatives with specific properties. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₇H₇BrO₂

InChI: InChI=1/C7H7BrO2/c1-4-2-5(9)3-6(10)7(4)8/h2-3,9-10H,1H3

SMILES: Cc1cc(cc(c1Br)O)O

4-Bromo-5-methylresorcinol

CAS: 3446-04-6

Formula: C₇H₇BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.0333

Ref: IN-DA00CN1L

4-Bromo-5-methylbenzene-1,3-diol

CAS: 3446-04-6

4-Bromo-5-methylbenzene-1,3-diol

Purity: 95%

Molecular weight: 203.03g/mol

Ref: 54-OR1004844

4-Bromo-5-methylbenzene-1,3-diol

Controlled Product

CAS: 3446-04-6

Applications 4-Bromo-5-methylbenzene-1,3-diol is used in the synthesis of phenanthrenes which displays antioxidant and anti-inflammatory activities.
References Kanekar, Y., et al.: Eur. J. Med. Chem., 67, 454-463 (2013)

Formula: C₇H₇BrO₂

Color and Shape: Neat

Molecular weight: 203.03

Ref: TR-B685458

4-BROMO-5-METHYLBENZENE-1,3-DIOL

CAS: 3446-04-6

Formula: C₇H₇BrO₂

Purity: 95%

Molecular weight: 203.035

Ref: 10-F468830