CymitQuimica logo

CAS 34461-00-2

:

Nitromalonaldehyde Sodium

Description:
Nitromalonaldehyde sodium, with the CAS number 34461-00-2, is a chemical compound that features a nitro group and an aldehyde functional group, making it an interesting molecule in organic synthesis. It typically appears as a solid and is soluble in polar solvents due to its ionic nature. The presence of both the nitro and aldehyde groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound is often used in the synthesis of more complex organic molecules and can serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure also makes it a subject of study in the field of materials science, particularly in the development of novel compounds with specific electronic or optical properties. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.
Formula:C3H2NO4
InChI:InChI=1/C3H3NO4/c5-1-3(2-6)4(7)8/h1-2,5H/p-1
InChI key:OQMLJRMYSFKMDS-UHFFFAOYSA-M
SMILES:C(=C(C=O)N(=O)=O)[O-]
Synonyms:
  • 2-Nitro-3-Oxoprop-1-En-1-Olate
  • sodium N-oxido-1,3-dioxopropanimine oxide hydrate
  • Sodium nitromalonaldehyde monohydrate
Found 3 products.