CAS 34467-12-4

ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride

Description:

Ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride, with the CAS number 34467-12-4, is a chemical compound characterized by its unique bicyclic structure that incorporates both imidazole and thiazole rings. This compound typically appears as a white to off-white solid and is soluble in polar solvents, which is common for many hydrochloride salts. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. The presence of the ethyl ester and the hydrochloride form may enhance its solubility and bioavailability. Additionally, the compound's specific functional groups contribute to its reactivity and interaction with biological systems. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound exemplifies the complexity and diversity of organic molecules used in medicinal chemistry.

Formula: C₉H₁₃ClN₂O₂S

InChI: InChI=1/C9H12N2O2S.ClH/c1-3-13-8(12)7-6(2)11-5-4-10-9(11)14-7;/h3-5H2,1-2H3;1H

SMILES: CCOC(=O)c1c(C)n2CCN=c2s1.Cl

Synonyms:

• Imidazo(2,1-b)thiazole-2-carboxylic acid, 5,6-dihydro-3-methyl-, ethyl ester, hydrochloride
• 3-Methyl-5,6-dihydroimidazo(2,1-b)thiazole-2-carboxylic acid ethyl ester hydrochloride
• Ethyl 3-Methyl-5,6-Dihydroimidazo[2,1-B][1,3]Thiazole-2-Carboxylate Hydrochloride (1:1)

Ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride

CAS: 34467-12-4

Ethyl 3-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carboxylate hydrochloride

Purity: ≥95%

Molecular weight: 248.73g/mol

Ref: 54-OR24490