CAS 34467-14-6

Ethyl 5,6-dihydroimidazo[2,1-b]thiazole-3-acetate

Description:

Ethyl 5,6-dihydroimidazo[2,1-b]thiazole-3-acetate is a chemical compound characterized by its unique bicyclic structure, which combines imidazole and thiazole rings. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of nitrogen and sulfur in its structure imparts distinct chemical reactivity, making it of interest in various synthetic applications, particularly in medicinal chemistry. Ethyl 5,6-dihydroimidazo[2,1-b]thiazole-3-acetate may exhibit biological activity, potentially serving as a scaffold for drug development. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific synthesis and purity of the compound. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in organic synthesis and pharmaceutical research.

Formula: C₉H₁₂N₂O₂S

InChI: InChI=1S/C9H12N2O2S/c1-2-13-8(12)5-7-6-14-9-10-3-4-11(7)9/h6H,2-5H2,1H3

InChI key: InChIKey=IWXSEVRNVJJFOY-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1N2C(SC1)=NCC2

Synonyms:

• NSC 633944
• (5,6-Dihydro-imidazo[2,1-b]thiazol-3-yl)-acetic acid ethyl ester
• Ethyl 5,6-dihydroimidazo[2,1-b]thiazole-3-acetate
• Imidazo[2,1-b]thiazole-3-acetic acid, 5,6-dihydro-, ethyl ester

Ethyl 5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-ylacetate

CAS: 34467-14-6

Versatile small molecule scaffold

Formula: C₉H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 212.27 g/mol

Ref: 3D-JBA46714