CAS 3447-53-8

4-(Difluoromethoxy)benzyl bromide

Description:

4-(Difluoromethoxy)benzyl bromide, with the CAS number 3447-53-8, is an organic compound characterized by its aromatic structure and the presence of both bromine and difluoromethoxy functional groups. This compound features a benzyl group attached to a difluoromethoxy substituent at the para position, which significantly influences its chemical reactivity and physical properties. The difluoromethoxy group enhances the compound's lipophilicity and can affect its solubility in various solvents. As a bromide, it is likely to participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the formation of carbon-carbon bonds or in the introduction of other functional groups. The presence of fluorine atoms typically imparts unique electronic properties, potentially increasing the compound's stability and reactivity under certain conditions. Overall, 4-(Difluoromethoxy)benzyl bromide is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as an intermediate in synthetic pathways.

Formula: C₈H₇BrF₂O

InChI: InChI=1/C8H7BrF2O/c9-5-6-1-3-7(4-2-6)12-8(10)11/h1-4,8H,5H2

SMILES: c1cc(ccc1CBr)OC(F)F

Synonyms:

• 1-(Bromomethyl)-4-(difluoromethoxy)benzene
• Benzene, 1-(bromomethyl)-4-(difluoromethoxy)-
• Fyfor D1E

4-(Difluoromethoxy)benzyl Bromide

CAS: 3447-53-8

Formula: C₈H₇BrF₂O

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 237.04

Ref: 3B-D4956

4-(DIFLUOROMETHOXY)BENZYL BROMIDE

CAS: 3447-53-8

Formula: C₈H₇BrF₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 237.0414

Ref: IN-DA00BZGB

4-(Difluoromethoxy)benzyl bromide

CAS: 3447-53-8

4-(Difluoromethoxy)benzyl bromide

Formula: C₈H₇BrF₂O

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 237.04g/mol

Ref: 54-PC2847Q

4-(Difluoromethoxy)benzyl bromide

CAS: 3447-53-8

Formula: C₈H₇BrF₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 237.044

Ref: 10-F004834