CAS 344790-87-0: 1-Butyl-3-methylimidazolium thiocyanate
Description:1-Butyl-3-methylimidazolium thiocyanate is an ionic liquid characterized by its unique combination of properties derived from its imidazolium cation and thiocyanate anion. This substance typically exhibits a low melting point, which allows it to remain in a liquid state at room temperature, making it suitable for various applications in green chemistry and as a solvent. Its structure includes a butyl group and a methyl group attached to the imidazolium ring, contributing to its hydrophobic nature and enhancing its solubility for a range of organic and inorganic compounds. The thiocyanate anion imparts specific reactivity and coordination properties, making it useful in catalysis and extraction processes. Additionally, ionic liquids like this one are known for their thermal stability, low volatility, and ability to dissolve a wide variety of substances, which can be advantageous in chemical synthesis and separation techniques. Overall, 1-butyl-3-methylimidazolium thiocyanate is a versatile compound with significant potential in both industrial and research applications.
Formula:C8H15N2·CNS
InChI:InChI=1S/C8H15N2.CHNS/c1-3-4-5-10-7-6-9(2)8-10;2-1-3/h6-8H,3-5H2,1-2H3;3H/q+1;/p-1
InChI key:InChIKey=SIXHYMZEOJSYQH-UHFFFAOYSA-M
SMILES:N#C[S-].C1=C[N+](=CN1C)CCCC
- Synonyms:
- 1-Butyl-3-Methylimidazolium Thiocyanate
- 1-Butyl-3-methyl-1H-imidazolium isothiocyanate
- 1-Methyl-3-butylimidazolium thiocyanate
- 1H-Imidazolium, 1-butyl-3-methyl-, thiocyanate
- 1H-Imidazolium, 3-butyl-1-methyl-, thiocyanate (1:1)
- Bmimscn
- Butylmethylimidazolium thiocyanate

1-Butyl-3-methylimidazolium Thiocyanate
Ref: 3B-B4091
5g | 39.00 € | ||
25g | 121.00 € |

1-Butyl-3-Methylimidazolium Thiocyanate
Ref: IN-DA003E6E
1g | 26.00 € | ||
5g | 31.00 € | ||
25g | 81.00 € |

Ref: 54-OR1009427
1g | 32.00 € | ||
5g | 36.00 € | ||
25g | 96.00 € | ||
100g | 339.00 € | ||
500g | 1,484.00 € |

Ref: 10-F988183
25g | 142.00 € | ||
100g | 208.00 € |

1-Butyl-3-methylimidazolium Thiocyanate
Ref: 3D-FB60691
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |