CAS 34484-77-0
:2,5-dimethyl-N-phenylpyrrolidine-1-carboxamide
Description:
2,5-Dimethyl-N-phenylpyrrolidine-1-carboxamide, with the CAS number 34484-77-0, is a chemical compound characterized by its pyrrolidine structure, which includes a five-membered ring containing nitrogen. This compound features two methyl groups at the 2 and 5 positions of the pyrrolidine ring, contributing to its steric and electronic properties. The presence of a phenyl group at the nitrogen atom enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. As a carboxamide, it possesses an amide functional group, which can participate in hydrogen bonding, affecting its reactivity and stability. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization typically involve standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, 2,5-dimethyl-N-phenylpyrrolidine-1-carboxamide represents a unique molecular framework with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H18N2O
InChI:InChI=1/C13H18N2O/c1-10-8-9-11(2)15(10)13(16)14-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3,(H,14,16)
SMILES:CC1CCC(C)N1C(=Nc1ccccc1)O
Synonyms:- 2,5-Dimethyl-1-Pyrrolidinecarboxanilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Cisanilide
CAS:<p>Cisanilide is an analog of indirubin, a natural compound found in human urine and glycerol. It has shown potent anticancer activity by inducing apoptosis in tumor cells. Cisanilide acts as a kinase inhibitor, blocking the activity of several Chinese hamster ovary (CHO) cell kinases that are involved in cancer cell growth and survival. This inhibitor has been shown to be effective against a variety of cancer types, making it a promising candidate for future cancer therapies.</p>Formula:C13H18N2OPurity:Min. 95%Molecular weight:218.29 g/mol
