CAS 34486-24-3
:2-Amino-6-(trifluoromethyl)pyridine
Description:
2-Amino-6-(trifluoromethyl)pyridine is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a pyridine ring. Its molecular structure consists of a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The trifluoromethyl group significantly influences the compound's electronic properties, enhancing its lipophilicity and potentially affecting its interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block in various chemical reactions. Additionally, the presence of both the amino and trifluoromethyl groups can impart unique characteristics, such as increased stability and altered reactivity, making it a valuable compound in medicinal chemistry and materials science. Safety data should be consulted, as compounds containing fluorine can pose specific health and environmental risks.
Formula:C6H5F3N2
InChI:InChI=1/C9H7F3O2/c1-14-8(13)6-4-2-3-5-7(6)9(10,11)12/h2-5H,1H3
SMILES:COC(=O)c1ccccc1C(F)(F)F
Synonyms:- 6-Trifluoromethyl-2-pyridinamine
- 6-(Trifluoromethyl)-2-Pyridinylamine
- 6-(trifluoromethyl)PYRIDIN-2-amine
- 4-(trifluoromethyl)PYRIDIN-2-amine
- 6-Trifluromethylpyridin-2-Amine
- 2-Amino-6-(trifloromethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-6-(trifluoromethyl)pyridine, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5F3N2Purity:98+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:162.122-Amino-6-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:98%Color and Shape:SolidMolecular weight:162.11252-Amino-6-(trifluoromethyl)pyridine
CAS:2-Amino-6-(trifluoromethyl)pyridineFormula:C6H5F3N2Purity:97%Color and Shape: white crystalline powderMolecular weight:162.11g/mol2-Amino-6-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Brown to Dark green powder to crystalMolecular weight:162.122-Amino-6-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:97%Color and Shape:SolidMolecular weight:162.115





