CAS 34490-85-2

[4-(ammoniomethyl)phenyl]-N,N-dimethylmethanaminium

Description:

The chemical substance known as [4-(ammoniomethyl)phenyl]-N,N-dimethylmethanaminium, with the CAS number 34490-85-2, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a phenyl ring substituted with an ammoniomethyl group, which contributes to its solubility in polar solvents and its potential applications in various fields, including biochemistry and materials science. The dimethyl groups attached to the nitrogen enhance its lipophilicity and stability. As a quaternary ammonium compound, it may exhibit antimicrobial properties, making it useful in disinfectants and antiseptics. Additionally, its structure suggests potential interactions with biological membranes, which could be relevant in drug delivery systems. Overall, this compound's unique structural features and properties make it a subject of interest in both industrial and research applications.

Formula: C₁₀H₁₈N₂

InChI: InChI=1/C10H16N2/c1-12(2)8-10-5-3-9(7-11)4-6-10/h3-6H,7-8,11H2,1-2H3/p+2

4-dimethylaminomethylbenzylamine

CAS: 34490-85-2

Formula: C₁₀H₁₆N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.2474

Ref: IN-DA00C6TY

N-[4-(Aminomethyl)benzyl]-N,N--dimethylamine

CAS: 34490-85-2

N-[4-(Aminomethyl)benzyl]-N,N--dimethylamine

Purity: 98%

Molecular weight: 164.25g/mol

Ref: 54-OR953945

[4-(aminomethyl)benzyl]dimethylamine

CAS: 34490-85-2

Formula: C₁₀H₁₆N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.252

Ref: 10-F049672