CAS 345-22-2

1-fluoro-2,4-dimethyl-5-nitrobenzene

Description:

1-Fluoro-2,4-dimethyl-5-nitrobenzene, with the CAS number 345-22-2, is an aromatic compound characterized by the presence of a fluorine atom, two methyl groups, and a nitro group attached to a benzene ring. The fluorine atom is typically positioned at the first carbon, while the methyl groups are located at the second and fourth carbons, and the nitro group is at the fifth carbon. This compound exhibits properties typical of nitro-substituted aromatic compounds, including potential reactivity due to the electron-withdrawing nature of the nitro group, which can influence its electrophilic substitution reactions. The presence of the fluorine atom can also enhance the compound's lipophilicity and alter its electronic properties. 1-Fluoro-2,4-dimethyl-5-nitrobenzene may be used in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. As with many nitro compounds, it may pose certain health and environmental risks, necessitating careful handling and disposal.

Formula: C₈H₈FNO₂

InChI: InChI=1/C8H8FNO2/c1-5-3-6(2)8(10(11)12)4-7(5)9/h3-4H,1-2H3

SMILES: Cc1cc(C)c(cc1F)N(=O)=O

Synonyms:

• 1,3-Dimethyl-4-fluoro-6-nitrobenzene

Benzene, 1-fluoro-2,4-dimethyl-5-nitro-

CAS: 345-22-2

Formula: C₈H₈FNO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 169.1530

Ref: IN-DA00CAI1

1-Fluoro-2,4-dimethyl-5-nitrobenzene

CAS: 345-22-2

1-Fluoro-2,4-dimethyl-5-nitrobenzene

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.15g/mol

Ref: 54-PC908761

1-Fluoro-2,4-dimethyl-5-nitrobenzene

CAS: 345-22-2

Formula: C₈H₈FNO₂

Purity: 95%

Molecular weight: 169.155

Ref: 10-F221059