CymitQuimica logo

CAS 345-28-8

:

methyl 2-hydroxy-4-(trifluoromethyl)benzoate

Description:
Methyl 2-hydroxy-4-(trifluoromethyl)benzoate, with the CAS number 345-28-8, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of a hydroxyl group (-OH) and a trifluoromethyl group (-CF3) attached to the aromatic ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in the fields of pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various chemical products. The trifluoromethyl group enhances its lipophilicity and biological activity, making it of interest in medicinal chemistry. Methyl 2-hydroxy-4-(trifluoromethyl)benzoate is also subject to study for its environmental impact and behavior, particularly in relation to its stability and degradation in various conditions. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and reactivity.
Formula:C9H7F3O3
InChI:InChI=1/C9H7F3O3/c1-15-8(14)6-3-2-5(4-7(6)13)9(10,11)12/h2-4,13H,1H3
InChI key:IRELIHAAUCMEDQ-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(cc1O)C(F)(F)F
Synonyms:
  • 2-Hydroxy-4-trifluoromethyl-benzoic acid methyl ester
Found 4 products.