CymitQuimica logo

CAS 345-32-4

:

5-(Trifluoromethyl)Isatin

Description:
5-(Trifluoromethyl)Isatin, with the CAS number 345-32-4, is an organic compound belonging to the isatin family, characterized by the presence of a trifluoromethyl group (-CF3) at the 5-position of the isatin structure. This compound typically exhibits a pale yellow to light brown solid appearance and is known for its significant biological activity, including potential applications in pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, which can influence its reactivity and interaction with biological targets. 5-(Trifluoromethyl)Isatin is also notable for its ability to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, making it a valuable intermediate in synthetic organic chemistry. Its unique electronic properties, derived from the electronegative fluorine atoms, contribute to its reactivity and potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many fluorinated compounds, handling precautions should be observed due to potential toxicity and environmental impact.
Formula:C9H4F3NO2
InChI:InChI=1S/C9H4F3NO2/c10-9(11,12)4-1-2-6-5(3-4)7(14)8(15)13-6/h1-3H,(H,13,14,15)
InChI key:WODYULWWVAMDCP-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C(F)(F)F)C(=O)C(=O)N2
Synonyms:
  • 5-(trifluoromethyl)indoline-2,3-dione
Found 5 products.