CymitQuimica logo

CAS 34500-18-0

:

2-(acetyloxy)ethyl 3-oxobutanoate

Description:
2-(Acetyloxy)ethyl 3-oxobutanoate, with the CAS number 34500-18-0, is an organic compound characterized by its ester functional groups and a keto group. This compound features a 3-oxobutanoate moiety, indicating the presence of a ketone adjacent to a carboxylate, which contributes to its reactivity and potential applications in organic synthesis. The acetyloxy group suggests that it can undergo hydrolysis, making it susceptible to nucleophilic attack, which is a common feature in esters. The ethyl group in the structure enhances its solubility in organic solvents, making it useful in various chemical reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its stability under standard conditions allows for handling and storage, but it should be kept away from strong bases or acids that could promote hydrolysis or other degradation reactions. Overall, 2-(acetyloxy)ethyl 3-oxobutanoate is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C8H12O5
InChI:InChI=1/C8H12O5/c1-6(9)5-8(11)13-4-3-12-7(2)10/h3-5H2,1-2H3
SMILES:CC(=O)CC(=O)OCCOC(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • AAEM Resin(Acetoacetoxyethyl Ketoester Resin)

    Controlled Product
    CAS:
    Formula:C8H12O5
    Color and Shape:Neat
    Molecular weight:188.18

    Ref: TR-A104495

    10g
    1,008.00€