CymitQuimica logo

CAS 345217-02-9

:

1-[(1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl]-N-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]hydrazinecarboxamide

Description:
The chemical substance known as 1-[(1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl]-N-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]hydrazinecarboxamide, with the CAS number 345217-02-9, is a complex organic compound characterized by its hydrazinecarboxamide functional group. This compound features a chiral center, indicated by the (1S,2S) configuration, which suggests that it may exhibit stereoisomerism, potentially influencing its biological activity and pharmacokinetics. The presence of a phenylmethoxy group and a piperazine moiety suggests that it may interact with various biological targets, possibly including receptors or enzymes. Additionally, the hydroxyl group on the phenyl ring may contribute to its solubility and reactivity. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry, where they may serve as lead compounds for drug development. Overall, the structural complexity and functional groups present in this molecule indicate that it could possess significant biological activity, warranting further research into its properties and potential uses.
Formula:C29H37N5O3
InChI:InChI=1S/C29H37N5O3/c1-3-28(22(2)37-21-23-7-5-4-6-8-23)34(30)29(36)31-24-9-11-25(12-10-24)32-17-19-33(20-18-32)26-13-15-27(35)16-14-26/h4-16,22,28,35H,3,17-21,30H2,1-2H3,(H,31,36)/t22-,28-/m0/s1
InChI key:InChIKey=OYVWMWMSNMDYQC-DWACAAAGSA-N
SMILES:N(C(N([C@H]([C@@H](OCC1=CC=CC=C1)C)CC)N)=O)C2=CC=C(N3CCN(CC3)C4=CC=C(O)C=C4)C=C2
Synonyms:
  • Hydrazinecarboxamide, 1-[(1S,2S)-1-ethyl-2-(phenylmethoxy)propyl]-N-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-
  • 1-[(1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl]-N-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]hydrazinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.