
CAS 34522-31-1
:N2-[(1R)-1-Carboxyethyl]-L-lysine
Description:
N2-[(1R)-1-Carboxyethyl]-L-lysine, with the CAS number 34522-31-1, is a derivative of the amino acid lysine, which is essential for protein synthesis and various metabolic processes. This compound features a carboxyethyl group attached to the nitrogen atom of the lysine side chain, which influences its biochemical properties and interactions. It is characterized by its polar nature due to the presence of carboxylic acid functional groups, which can participate in hydrogen bonding and ionic interactions. This compound is likely to be soluble in water, making it relevant in biological systems. Its structure suggests potential roles in metabolic pathways, possibly acting as a precursor or intermediate in the synthesis of other biomolecules. Additionally, the stereochemistry indicated by the (1R) designation suggests specific spatial arrangements that may affect its biological activity and interactions with enzymes or receptors. Overall, N2-[(1R)-1-Carboxyethyl]-L-lysine is of interest in biochemical research, particularly in studies related to amino acid metabolism and protein function.
Formula:C9H18N2O4
InChI:InChI=1S/C9H18N2O4/c1-6(8(12)13)11-7(9(14)15)4-2-3-5-10/h6-7,11H,2-5,10H2,1H3,(H,12,13)(H,14,15)/t6-,7+/m1/s1
InChI key:InChIKey=ZZYYVZYAZCMNPG-RQJHMYQMSA-N
SMILES:[C@H](N[C@@H](C(O)=O)C)(CCCCN)C(O)=O
Synonyms:- N2-[(1R)-1-Carboxyethyl]-L-lysine
- Lysine, N2-(1-carboxyethyl)-, D-
- Lysopine
- L-Lysine, N2-[(1R)-1-carboxyethyl]-
- L-Lysine, N2-(1-carboxyethyl)-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lysopine
CAS:Lysopine is a bioactive chemical.Formula:C9H18N2O4Color and Shape:SolidMolecular weight:218.25
