CAS 34522-38-8

1-methylspiro[pyrrolidine-3,2'-tricyclo[3.3.1.1~3,7~]decane] but-2-enedioate (1:1)

Description:

1-Methylspiro[pyrrolidine-3,2'-tricyclo[3.3.1.1^3,7]decane] but-2-enedioate (1:1), with CAS number 34522-38-8, is a complex organic compound characterized by its unique spirocyclic structure. This substance features a pyrrolidine ring fused to a tricyclic decane framework, which contributes to its rigidity and potential stereochemical diversity. The presence of a but-2-enedioate moiety indicates that it contains a dicarboxylic acid derivative, which may impart specific reactivity and solubility characteristics. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its intricate arrangement of functional groups and rings that may influence biological activity. Additionally, the spiro configuration can lead to interesting conformational properties, affecting how the molecule interacts with biological targets. Overall, this compound exemplifies the complexity often found in organic chemistry, where structural nuances can significantly impact chemical behavior and potential applications.

Formula: C₁₈H₂₇NO₄

InChI: InChI=1/C14H23N.C4H4O4/c1-15-3-2-14(9-15)12-5-10-4-11(7-12)8-13(14)6-10;5-3(6)1-2-4(7)8/h10-13H,2-9H2,1H3;1-2H,(H,5,6)(H,7,8)

DU-34569 Maleate

CAS: 34522-38-8

DU-34569 Maleate, an antiviral agent, acts against influenza A, parainfluenza Sendai, coxsackie A21, and rhinovirus.

Formula: C₁₈H₂₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 321.41

Ref: TM-T27216