CAS 34523-28-9: 5-(Dimethylamino)-1-naphthalenesulfonyl fluoride

Description:5-(Dimethylamino)-1-naphthalenesulfonyl fluoride, with the CAS number 34523-28-9, is a chemical compound characterized by its sulfonyl fluoride functional group attached to a naphthalene ring. This compound is typically used as a reagent in organic synthesis, particularly in the development of sulfonamide derivatives and as a labeling agent in biochemical applications. It exhibits a strong electrophilic nature due to the presence of the sulfonyl fluoride group, making it reactive towards nucleophiles. The dimethylamino group enhances its solubility in organic solvents and can influence its reactivity and interaction with biological molecules. The compound is generally handled with care due to its potential toxicity and reactivity, necessitating appropriate safety measures during use. Its unique structural features contribute to its utility in various chemical reactions, particularly in the fields of medicinal chemistry and biochemistry.

Formula:C₁₂H₁₂FNO₂S

InChI:InChI=1S/C12H12FNO2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3

InChI key:InChIKey=JMHHECQPPFEVMU-UHFFFAOYSA-N

SMILES:O=S(=O)(F)C1=CC=CC=2C1=CC=CC2N(C)C

Synonyms:
1-Naphthalenesulfonyl fluoride, 5-(dimethylamino)-
5-(Dimethylamino)naphthalene-1-sulfonyl fluoride
5-(Dimethylamino)naphthalene-1-sulphonyl fluoride
5-Dimethylamino-1-naphthalenesulfonyl fluoride
Dansyl fluoride

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Dansyl Fluoride REF: 3B-D2197CAS: 34523-28-9	>98.0%(T)(HPLC)	138.00 €	Tue 05 Aug 25
Dansyl fluoride REF: IN-DA003P8GCAS: 34523-28-9	98%	71.00 €~266.00 €	Tue 12 Aug 25
Dansyl Fluoride REF: 54-PC109008CAS: 34523-28-9	98%	40.00 €~1,060.00 €	Wed 13 Aug 25
Dansyl fluoride REF: 10-F013104CAS: 34523-28-9	98.0%	To inquire	Fri 22 Aug 25
Dansyl Fluoride REF: 3D-JBA52328CAS: 34523-28-9	Min. 95%	- - -	Discontinued product