CAS 34523-31-4
:N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide
Description:
N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide, also known by its CAS number 34523-31-4, is an organic compound characterized by its sulfonamide functional group, which is attached to a methyl group and a para-hydroxyphenyl moiety. This compound typically exhibits properties associated with sulfonamides, such as being soluble in polar solvents and having moderate stability under standard conditions. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its solubility and reactivity. Additionally, the aromatic rings in its structure may impart certain electronic properties, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound's biological activity can be attributed to its ability to interact with biological targets, which may include enzymes or receptors, thus making it of interest in medicinal chemistry. Overall, N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C13H13NO3S
InChI:InChI=1/C13H13NO3S/c1-14(11-7-9-12(15)10-8-11)18(16,17)13-5-3-2-4-6-13/h2-10,15H,1H3
SMILES:CN(c1ccc(cc1)O)S(=O)(=O)c1ccccc1
Synonyms:- N-(4-Hydroxy-phenyl)-N-methyl-benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
