CymitQuimica logo

CAS 345311-03-7

:

tert-butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate

Description:
Tert-butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrazine moieties. This compound features a tert-butyl ester group, contributing to its solubility and stability in various organic solvents. The presence of the carboxylate functional group suggests potential reactivity, particularly in esterification or amidation reactions. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 345311-03-7, allows for precise identification and retrieval of information in chemical databases. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its identity and purity. Overall, tert-butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate represents a versatile scaffold for further chemical modifications and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H17N3O2
InChI:InChI=1/C11H17N3O2/c1-11(2,3)16-10(15)14-7-6-13-5-4-12-9(13)8-14/h4-5H,6-8H2,1-3H3
InChI key:WDHIKONIOJKMIK-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCn2ccnc2C1
Synonyms:
  • Imidazo[1,2-a]pyrazine-7(8H)-carboxylic acid, 5,6-dihydro-, 1,1-dimethylethyl ester
  • tert-Butyl 5,6-dihydroimidazo[1,2-a]pyrazine-7(8H)-carboxylate
Found 4 products.