CAS 34539-65-6
:(1S)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl 3-methylbut-2-enoate
Description:
The chemical substance known as "(1S)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl 3-methylbut-2-enoate," with the CAS number 34539-65-6, is a complex organic compound characterized by its unique structural features. It contains a naphthalene derivative with multiple functional groups, including hydroxyl and carbonyl groups, which contribute to its reactivity and potential biological activity. The presence of the dioxo moiety suggests that it may participate in various chemical reactions, including oxidation and conjugation. The compound also features a pentene and an ester functional group, indicating potential for further chemical transformations. Its stereochemistry, denoted by the (1S) configuration, implies specific spatial arrangements that can influence its interactions in biological systems. Overall, this compound may exhibit interesting properties, making it a subject of interest in fields such as medicinal chemistry, where its derivatives could be explored for therapeutic applications.
Formula:C21H22O6
InChI:InChI=1/C21H22O6/c1-11(2)5-8-17(27-18(25)9-12(3)4)13-10-16(24)19-14(22)6-7-15(23)20(19)21(13)26/h5-7,9-10,17,22-23H,8H2,1-4H3/t17-/m0/s1
SMILES:CC(=CC[C@@H](C1=CC(=O)c2c(ccc(c2C1=O)O)O)OC(=O)C=C(C)C)C
Synonyms:- 2-butenoic acid, 3-methyl-, (1S)-1-(1,4-dihydro-5,8-dihydroxy-1,4-dioxo-2-naphthalenyl)-4-methyl-3-penten-1-yl ester
- beta,beta-Dimethylacrylalkannin
- Dimethylacrylalkannin, β,β-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethylacrylalkannin, β,β-
CAS:Formula:C21H22O6Purity:95%~99%Color and Shape:Reddish brown powderMolecular weight:370.401Dimethylacrylalkannin
CAS:β,β-Dimethylacrylalkannin is a natural product isolated from Arnebia nobilis Reichb.f, increases collagen and involucrin content in skin cells.
Formula:C21H22O6Purity:98.85% - ≥95%Color and Shape:SolidMolecular weight:370.4Ref: TM-T5703
2mg35.00€5mg50.00€10mg70.00€25mg100.00€50mg144.00€100mg205.00€200mg304.00€1mL*10mM (DMSO)55.00€Beta,beta-Dimethylacrylalkannin
CAS:Beta,beta-Dimethylacrylalkannin is a naturally derived naphthoquinone compound, which is extracted from the roots of the Alkanna tinctoria plant. This compound exhibits a characteristic reddish pigment and is known for its potent biological activities. Its action is primarily based on its ability to function as an antioxidant, a property attributed to its unique molecular configuration that allows the neutralization of reactive oxygen species. Furthermore, Beta,beta-Dimethylacrylalkannin demonstrates antimicrobial properties, making it effective against a variety of pathogenic microorganisms.
Formula:C21H22O6Purity:Min. 95%Color and Shape:Dark To Red SolidMolecular weight:370.4 g/mol





