CAS 3455-50-3
:2-(diethoxymethyl)-5-nitrofuran
Description:
2-(Diethoxymethyl)-5-nitrofuran, identified by its CAS number 3455-50-3, is a chemical compound that belongs to the furan family, characterized by a five-membered aromatic ring containing oxygen. This compound features a nitro group (-NO2) at the 5-position and a diethoxymethyl group at the 2-position, which contributes to its unique reactivity and properties. Typically, nitrofuran derivatives are known for their biological activity, including antimicrobial properties, making them of interest in pharmaceutical research. The presence of the diethoxymethyl group may enhance solubility and stability in various solvents. In terms of physical properties, compounds of this class often exhibit moderate to high melting points and can be sensitive to light and moisture. Additionally, the nitro group can participate in reduction reactions, potentially leading to the formation of various derivatives. Safety data should be consulted for handling and storage, as nitro compounds can pose risks such as toxicity and environmental hazards. Overall, 2-(diethoxymethyl)-5-nitrofuran is a compound with significant potential in both synthetic and medicinal chemistry.
Formula:C9H13NO5
InChI:InChI=1/C9H13NO5/c1-3-13-9(14-4-2)7-5-6-8(15-7)10(11)12/h5-6,9H,3-4H2,1-2H3
SMILES:CCOC(c1ccc(N(=O)=O)o1)OCC
Synonyms:- Furan, 2-(diethoxymethyl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

