CAS 34550-49-7: 7-chloro-7aH-[1,2,3]triazolo[4,5-b]pyridine

Description:7-Chloro-7aH-[1,2,3]triazolo[4,5-b]pyridine is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a chlorine atom at the 7-position of the triazole ring, which can influence its reactivity and biological activity. The presence of both triazole and pyridine moieties contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities, including antimicrobial and anticancer properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine substituent, which may affect its synthesis and application in various chemical reactions. Overall, 7-chloro-7aH-[1,2,3]triazolo[4,5-b]pyridine is a compound of interest in both synthetic and medicinal chemistry.

Formula:C₅H₃ClN₄

InChI:InChI=1/C5H3ClN4/c6-3-1-2-7-5-4(3)8-10-9-5/h1-2,4H

Found 5 products.

Product data	Purity	Price range	Estimated delivery
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine REF: IN-DA00CLMPCAS: 34550-49-7	97%	To inquire	Mon 05 May 25
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine REF: 54-OR73468CAS: 34550-49-7	95%	568.00 €~1,854.00 €	Tue 06 May 25
7-chloro-1H-[1,2,3]triazolo[4,5-b]pyridine REF: 10-F791819CAS: 34550-49-7	97%	35.00 €~1,086.00 €	Tue 06 May 25
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine REF: 10-F220918CAS: 34550-49-7	95.0%	To inquire	Tue 13 May 25
7-Chloro-3H-[1,2,3]triazolo[4,5-b]pyridine REF: 3D-FC162119CAS: 34550-49-7	Min. 95%	- - -	Discontinued product