CAS 34552-16-4

2-bromo-3-fluoro-5-methyl-pyridine

Description:

2-Bromo-3-fluoro-5-methyl-pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 2-position, a fluorine atom at the 3-position, and a methyl group at the 5-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits polar characteristics due to the presence of halogen substituents, which can influence its reactivity and solubility in various solvents. The presence of both bromine and fluorine atoms makes it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the methyl group contributes to the compound's hydrophobic properties, affecting its interaction with biological systems. Its reactivity can be attributed to the electrophilic nature of the halogen substituents, making it suitable for further chemical transformations. Safety precautions should be taken when handling this compound, as halogenated pyridines can be toxic and may pose environmental hazards.

Formula: C₆H₅BrFN

InChI: InChI=1/C6H5BrFN/c1-4-2-5(8)6(7)9-3-4/h2-3H,1H3

SMILES: Cc1cc(c(Br)nc1)F

Synonyms:

• 2-Bromo-3-Fluoro-5-Methylpyridine
• Pyridine, 2-Bromo-3-Fluoro-5-Methyl-

2-Bromo-3-fluoro-5-methylpyridine

CAS: 34552-16-4

Formula: C₆H₅BrFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.0130

Ref: IN-DA00380Q

2-Bromo-3-fluoro-5-methylpyridine

CAS: 34552-16-4

2-Bromo-3-fluoro-5-methylpyridine

Purity: 98%

Molecular weight: 190.01g/mol

Ref: 54-PC408224

2-Bromo-3-fluoro-5-methylpyridine

CAS: 34552-16-4

Formula: C₆H₅BrFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.015

Ref: 10-F219391