CAS 345631-78-9

3-pyridin-3-yl-1,2,4-oxadiazole-5(2H)-thione

Description:

3-Pyridin-3-yl-1,2,4-oxadiazole-5(2H)-thione is a heterocyclic compound characterized by the presence of both a pyridine ring and an oxadiazole moiety. The structure features a thione functional group, which is a sulfur-containing derivative of a ketone. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may show varying degrees of stability depending on environmental conditions. It is of interest in medicinal chemistry and materials science due to its potential biological activities, including antimicrobial and anticancer properties. The presence of the pyridine ring can enhance its ability to interact with biological targets, while the oxadiazole structure may contribute to its electronic properties. Additionally, the thione group can participate in various chemical reactions, making this compound versatile for synthetic applications. Overall, 3-pyridin-3-yl-1,2,4-oxadiazole-5(2H)-thione is a compound of interest for further research in both theoretical and applied chemistry contexts.

Formula: C₇H₅N₃OS

InChI: InChI=1/C7H5N3OS/c12-7-9-6(10-11-7)5-2-1-3-8-4-5/h1-4H,(H,9,10,12)

SMILES: c1cc(cnc1)c1nc(=S)o[nH]1

Synonyms:

• 1,2,4-Oxadiazole-5-Thiol, 3-(3-Pyridinyl)-
• 3-(Pyridin-3-Yl)-1,2,4-Oxadiazole-5-Thiol

3-(Pyridin-3-yl)-1,2,4-oxadiazole-5-thiol

CAS: 345631-78-9

Versatile small molecule scaffold

Formula: C₇H₅N₃OS

Purity: Min. 95%

Molecular weight: 179.2 g/mol

Ref: 3D-VNA63178