CAS 345637-71-0
:(5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid
Description:
(5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid is a chemical compound characterized by its pyrazole ring structure, which is substituted with a methyl group and a trifluoromethyl group. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The pyrazole moiety is known for its diverse applications, particularly in medicinal chemistry, where it can exhibit anti-inflammatory, analgesic, and antipyretic properties. The compound's molecular structure allows for potential interactions with various biological targets, which may lead to the development of novel therapeutic agents. Additionally, the presence of fluorine atoms often imparts unique electronic properties, affecting the compound's reactivity and stability. Overall, (5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid is a compound of interest due to its structural features and potential applications in drug development.
Formula:C7H7F3N2O2
InChI:InChI=1S/C7H7F3N2O2/c1-4-2-5(7(8,9)10)11-12(4)3-6(13)14/h2H,3H2,1H3,(H,13,14)
InChI key:InChIKey=RBHQAIFXLJIFFM-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1N=C(C(F)(F)F)C=C1C
Synonyms:- (5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid
- 1H-Pyrazole-1-acetic acid, 5-methyl-3-(trifluoromethyl)-
- 2-[5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid
- 2-[5-Methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid
- 5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-acetic acid
- 5-Methyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid
- 5-methyl-3-(trifluoromethyl)-1H-Pyrazole-1-aceticacid
- In-Wr 791
- [5-Methyl-3-[trifluoromethyl]-1H-pyrazol-1-yl]acetic acid
- [5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetic acid
CAS:Formula:C7H7F3N2O2Purity:95%Color and Shape:SolidMolecular weight:208.13792-(5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetic acid
CAS:2-(5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetic acidFormula:C7H7F3N2O2Purity:95%Color and Shape: off white to faint beige crystalline powderMolecular weight:208.14g/mol[5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid
CAS:[5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid is a reaction component that can be used in organic synthesis as a reagent. This chemical has been shown to have high quality, and is useful for research purposes. It is also a versatile building block and useful intermediate, which can be used in the production of complex compounds. [5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid has CAS number 345637-71-0, and is a fine chemical that is useful for chemistry research.Formula:C7H7F3N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:208.14 g/mol(5-Methyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid
CAS:Formula:C7H7F3N2O2Purity:98%Color and Shape:SolidMolecular weight:208.14(5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic Acid
CAS:Controlled ProductApplications [5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetic acid (cas# 345637-71-0) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C7H7N2O2F3Color and Shape:NeatMolecular weight:208.14




