
CAS 34564-13-1
:7-(Diethylamino)-3-(5-methyl-2-benzoxazolyl)coumarin
Description:
7-(Diethylamino)-3-(5-methyl-2-benzoxazolyl)coumarin, identified by its CAS number 34564-13-1, is a synthetic organic compound that belongs to the coumarin family. This compound is characterized by its coumarin backbone, which is fused with a benzoxazole moiety and substituted with a diethylamino group. The presence of the diethylamino group enhances its solubility in organic solvents and may influence its photophysical properties. Coumarins are known for their fluorescence, and this particular compound exhibits significant fluorescent properties, making it useful in various applications, including as a fluorescent probe in biological imaging and as a dye in materials science. The compound's structure contributes to its potential as a selective marker in biochemical assays. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and solvent polarity. Overall, 7-(Diethylamino)-3-(5-methyl-2-benzoxazolyl)coumarin is notable for its unique structural features and versatile applications in research and industry.
Formula:C21H20N2O3
InChI:InChI=1S/C21H20N2O3/c1-4-23(5-2)15-8-7-14-11-16(21(24)26-19(14)12-15)20-22-17-10-13(3)6-9-18(17)25-20/h6-12H,4-5H2,1-3H3
InChI key:InChIKey=PTAGJQADNFQMGR-UHFFFAOYSA-N
SMILES:O=C1C(C=2OC=3C(N2)=CC(C)=CC3)=CC=4C(O1)=CC(N(CC)CC)=CC4
Synonyms:- Coumarin, 7-(diethylamino)-3-(5-methyl-2-benzoxazolyl)-
- 7-(Diethylamino)-3-(5-methyl-2-benzoxazolyl)-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 7-(diethylamino)-3-(5-methyl-2-benzoxazolyl)-
- 7-(Diethylamino)-3-(5-methyl-2-benzoxazolyl)coumarin
- 3-(5-Methyl-2-benzoxazolyl)-7-(diethylamino)-2H-1-benzopyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
EMI48
CAS:EMI48, a derivative of EMI1, exhibits increased efficacy against mutant EGFR compared to EMI1. It specifically inhibits EGFR triple mutants [1].Formula:C21H20N2O3Color and Shape:SolidMolecular weight:348.4
