CymitQuimica logo

CAS 34565-32-7

:

(6S)-6-[(1S)-1-hydroxypentyl]-4-methoxy-5,6-dihydro-2H-pyran-2-one

Description:
The chemical substance known as (6S)-6-[(1S)-1-hydroxypentyl]-4-methoxy-5,6-dihydro-2H-pyran-2-one, with the CAS number 34565-32-7, is a pyranone derivative characterized by its unique structural features. This compound contains a pyran ring, which is a six-membered cyclic ether with one oxygen atom, and is substituted with a methoxy group and a hydroxypentyl chain. The presence of stereocenters in its structure indicates that it can exist in multiple stereoisomeric forms, with specific configurations contributing to its biological activity and properties. The hydroxyl group enhances its solubility in polar solvents, while the methoxy group may influence its reactivity and interaction with biological systems. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and natural product research. The specific stereochemistry and functional groups present in this molecule can significantly affect its behavior in chemical reactions and its interactions with biological targets.
Formula:C11H18O4
InChI:InChI=1/C11H18O4/c1-3-4-5-9(12)10-6-8(14-2)7-11(13)15-10/h7,9-10,12H,3-6H2,1-2H3/t9-,10-/m0/s1
SMILES:CCCC[C@@H]([C@@H]1CC(=CC(=O)O1)OC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.