CAS 34569-34-1

1-(Dimethylamino)-3-(methylamino)-2-propanol

Description:

1-(Dimethylamino)-3-(methylamino)-2-propanol, with the CAS number 34569-34-1, is an organic compound characterized by its amino alcohol structure. It features a propanol backbone with two amino groups: a dimethylamino group and a methylamino group, which contribute to its basicity and potential reactivity. This compound is typically a colorless to pale yellow liquid and is soluble in water due to the presence of hydroxyl and amino functional groups. Its molecular structure allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of multiple amine groups makes it a potential candidate for applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, its properties may vary based on the specific conditions such as temperature and pH, influencing its behavior in different chemical environments. Safety data should be consulted for handling and storage, as compounds with amine functionalities can exhibit varying degrees of toxicity and reactivity.

Formula: C₆H₁₆N₂O

InChI: InChI=1S/C6H16N2O/c1-7-4-6(9)5-8(2)3/h6-7,9H,4-5H2,1-3H3

InChI key: InChIKey=ZISBGZVIQGRTRQ-UHFFFAOYSA-N

SMILES: C(C(CNC)O)N(C)C

Synonyms:

• 1-(Dimethylamino)-3-(methylamino)-2-propanol
• [3-(Dimethylamino)-2-hydroxypropyl](methyl)amine
• 2-Propanol, 1-(dimethylamino)-3-(methylamino)-

[3-(Dimethylamino)-2-hydroxypropyl](methyl)amine

CAS: 34569-34-1

Versatile small molecule scaffold

Formula: C₆H₁₆N₂O

Purity: Min. 95%

Molecular weight: 132.2 g/mol

Ref: 3D-JBA56934