CymitQuimica logo

CAS 34575-25-2

:

4,4-dimethyl-2-(propan-2-yl)-4,5-dihydro-1,3-oxazole

Description:
4,4-Dimethyl-2-(propan-2-yl)-4,5-dihydro-1,3-oxazole is a heterocyclic organic compound characterized by its oxazole ring, which is a five-membered ring containing both nitrogen and oxygen atoms. This compound features two methyl groups and an isopropyl group, contributing to its unique structure and properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the oxazole ring imparts certain reactivity, making it useful in various chemical syntheses and applications. The compound may exhibit moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and light. Additionally, it may have potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c1-6(2)7-9-8(3,4)5-10-7/h6H,5H2,1-4H3
SMILES:CC(C)C1=NC(C)(C)CO1
Synonyms:
  • Oxazole, 4,5-dihydro-4,4-dimethyl-2-(1-methylethyl)-
  • 2-ISOPROPYL-4,4-DIMETHYL-4,5-DIHYDRO-1,3-OXAZOLE
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.