CymitQuimica logo

CAS 34576-89-1

:

3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate

Description:
3,7-Dichloro-6-methoxy-1-benzothiophene-2-carboxylate is a chemical compound that belongs to the class of benzothiophene derivatives, which are known for their diverse biological activities and potential applications in pharmaceuticals. This compound features a benzothiophene core, characterized by a fused benzene and thiophene ring, which contributes to its aromatic properties and stability. The presence of two chlorine atoms at the 3 and 7 positions enhances its reactivity and may influence its biological interactions. The methoxy group at the 6 position serves as an electron-donating substituent, potentially affecting the compound's solubility and reactivity. The carboxylate group at the 2 position indicates that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. Overall, the structural features of 3,7-dichloro-6-methoxy-1-benzothiophene-2-carboxylate suggest it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.
Formula:C10H5Cl2O3S
InChI:InChI=1/C10H6Cl2O3S/c1-15-5-3-2-4-6(11)9(10(13)14)16-8(4)7(5)12/h2-3H,1H3,(H,13,14)/p-1
SMILES:COc1ccc2c(c(C(=O)[O-])sc2c1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.