CAS 34576-94-8
:3,6-dichloro-1-benzothiophene-2-carboxylate
Description:
3,6-Dichloro-1-benzothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiophene ring system substituted with two chlorine atoms and a carboxylate group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing chlorine atoms. The carboxylate functional group can influence its solubility and reactivity, making it a candidate for various chemical reactions, including esterification and nucleophilic substitutions. The presence of chlorine atoms may also impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's molecular structure suggests potential applications in materials science and organic synthesis. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential, particularly in terms of persistence and bioaccumulation. Overall, 3,6-dichloro-1-benzothiophene-2-carboxylate represents a versatile compound with potential applications across multiple fields of chemistry.
Formula:C9H3Cl2O2S
InChI:InChI=1/C9H4Cl2O2S/c10-4-1-2-5-6(3-4)14-8(7(5)11)9(12)13/h1-3H,(H,12,13)/p-1
SMILES:c1cc2c(cc1Cl)sc(c2Cl)C(=O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
BT2
CAS:BT2 inhibits BDK (IC50: 3.19 μM) & Mcl-1 (Ki: 59 μM), causing helix shift & BDK detachment from BCKDC.
Formula:C9H4Cl2O2SPurity:99.27% - 99.86%Color and Shape:SolidMolecular weight:247.13,6-DICHLORO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID
CAS:Formula:C9H4Cl2O2SPurity:97%Color and Shape:SolidMolecular weight:247.09793,6-Dichloro-benzo[b]thiophene-2-carboxylic acid
CAS:3,6-Dichloro-benzo[b]thiophene-2-carboxylic acidPurity:95%Molecular weight:247.101g/mol3,6-dichloro-1-benzothiophene-2-carboxylic acid
CAS:Formula:C9H4Cl2O2SPurity:95%Color and Shape:SolidMolecular weight:247.093,6-Dichlorobenzo[b]thiophene-2-carboxylic acid
CAS:3,6-Dichlorobenzo[b]thiophene-2-carboxylic acid is an extracellular metabolite that is involved in the metabolism of muscle. It is produced as a byproduct of the reaction catalyzed by dehydrogenase, which converts 3,6-dichlorobenzo[b]thiophene to 2-carboxybenzothiophene. This compound has been shown to inhibit the enzyme histidine carboxylate synthetase, which is involved in branched-chain amino acid synthesis. The enzyme can be inhibited by either a wild type or an analog of 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid.Formula:C9H4Cl2O2SPurity:Min. 95%Molecular weight:247.1 g/mol




