CAS 34576-94-8

3,6-dichloro-1-benzothiophene-2-carboxylate

Description:

3,6-Dichloro-1-benzothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiophene ring system substituted with two chlorine atoms and a carboxylate group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing chlorine atoms. The carboxylate functional group can influence its solubility and reactivity, making it a candidate for various chemical reactions, including esterification and nucleophilic substitutions. The presence of chlorine atoms may also impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's molecular structure suggests potential applications in materials science and organic synthesis. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential, particularly in terms of persistence and bioaccumulation. Overall, 3,6-dichloro-1-benzothiophene-2-carboxylate represents a versatile compound with potential applications across multiple fields of chemistry.

Formula: C₉H₃Cl₂O₂S

InChI: InChI=1/C9H4Cl2O2S/c10-4-1-2-5-6(3-4)14-8(7(5)11)9(12)13/h1-3H,(H,12,13)/p-1

SMILES: c1cc2c(cc1Cl)sc(c2Cl)C(=O)[O-]

BT2

CAS: 34576-94-8

BT2 inhibits BDK (IC50: 3.19 μM) & Mcl-1 (Ki: 59 μM), causing helix shift & BDK detachment from BCKDC.

Formula: C₉H₄Cl₂O₂S

Purity: 99.27% - 99.86%

Color and Shape: Solid

Molecular weight: 247.1

Ref: TM-T14834

3,6-DICHLORO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID

CAS: 34576-94-8

Formula: C₉H₄Cl₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 247.0979

Ref: IN-DA00CJAV

BT2

CAS: 34576-94-8

BT2

Purity: ≥98%

Molecular weight: 247.1g/mol

Ref: 54-BUP11289

3,6-Dichloro-benzo[b]thiophene-2-carboxylic acid

CAS: 34576-94-8

3,6-Dichloro-benzo[b]thiophene-2-carboxylic acid

Purity: 95%

Molecular weight: 247.101g/mol

Ref: 54-OR97406

3,6-dichloro-1-benzothiophene-2-carboxylic acid

CAS: 34576-94-8

Formula: C₉H₄Cl₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 247.09

Ref: 10-F364740

3,6-Dichlorobenzo[b]thiophene-2-carboxylic acid

CAS: 34576-94-8

3,6-Dichlorobenzo[b]thiophene-2-carboxylic acid is an extracellular metabolite that is involved in the metabolism of muscle. It is produced as a byproduct of the reaction catalyzed by dehydrogenase, which converts 3,6-dichlorobenzo[b]thiophene to 2-carboxybenzothiophene. This compound has been shown to inhibit the enzyme histidine carboxylate synthetase, which is involved in branched-chain amino acid synthesis. The enzyme can be inhibited by either a wild type or an analog of 3,6-dichlorobenzo[b]thiophene-2-carboxylic acid.

Formula: C₉H₄Cl₂O₂S

Purity: Min. 95%

Molecular weight: 247.1 g/mol

Ref: 3D-FD57151