CymitQuimica logo

CAS 34576-95-9

:

3,4-Dichlorobenzo[b]thiophene-2-carboxylic acid

Description:
3,4-Dichlorobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with two chlorine atoms and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the thiophene ring, which contributes to its stability and reactivity. The chlorine substituents enhance its electrophilic character, making it potentially useful in various chemical reactions, including electrophilic aromatic substitution. The carboxylic acid group provides acidic properties, allowing for potential interactions with bases and facilitating the formation of salts or esters. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may be sensitive to light and moisture, necessitating careful handling and storage. Overall, 3,4-Dichlorobenzo[b]thiophene-2-carboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C9H4Cl2O2S
InChI:InChI=1S/C9H4Cl2O2S/c10-4-2-1-3-5-6(4)7(11)8(14-5)9(12)13/h1-3H,(H,12,13)
InChI key:InChIKey=OIWHDKKVGXWDEW-UHFFFAOYSA-N
SMILES:ClC=1C=2C(SC1C(O)=O)=CC=CC2Cl
Synonyms:
  • 3,4-Dichlorobenzo[b]thiophene-2-carboxylic acid
  • Benzo[b]thiophene-2-carboxylic acid, 3,4-dichloro-
  • 3,4-Dichloro-1-benzothiophene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.