CAS 3458-14-8
:5'-deoxythymidine
Description:
5'-Deoxythymidine, also known as deoxythymidine or thymidine, is a nucleoside that plays a crucial role in the structure of DNA. It consists of a thymine base attached to a deoxyribose sugar, lacking a hydroxyl group at the 2' position, which distinguishes it from ribonucleosides. The chemical formula of 5'-deoxythymidine is C10H13N2O4, and it has a molecular weight of approximately 227.24 g/mol. This compound is essential for DNA synthesis and repair, as it serves as a building block for the formation of DNA strands. In biological systems, it is phosphorylated to form deoxythymidine monophosphate (dTMP), which can further be converted into deoxythymidine triphosphate (dTTP), a key substrate for DNA polymerases during DNA replication. 5'-Deoxythymidine is also used in various biochemical and pharmaceutical applications, including antiviral therapies and research involving nucleic acids. Its stability and solubility in aqueous solutions make it a valuable compound in molecular biology.
Formula:C10H14N2O4
InChI:InChI=1/C10H14N2O4/c1-5-4-12(10(15)11-9(5)14)8-3-7(13)6(2)16-8/h4,6-8,13H,3H2,1-2H3,(H,11,14,15)/t6-,7+,8-/m1/s1
Synonyms:- 2',5'-Dideoxythymidine
- 5'-Ddthd
- Thymidine, 5'-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-deoxy Thymidine
CAS:5'-Deoxythymidine: a thymidine variant with hydrogen at the 5' position; combats Bacillus subtilis and Staphylococcus aureus.Formula:C10H14N2O4Purity:99.72%Color and Shape:SolidMolecular weight:226.235'-Deoxythymidine
CAS:5'-Deoxythymidine is a nucleoside analog with low-energy electrons. This drug inhibits the synthesis of DNA by binding to the ribonucleotide reductase enzyme and preventing the conversion of ribonucleotides to deoxyribonucleotides. 5'-Deoxythymidine has been shown to inhibit cell growth in tumor cell lines, which may be due to its ability to interfere with mirna-mediated gene expression. This drug also has a kinetic effect on regulatory proteins, such as cyclin-dependent kinases, that are involved in the regulation of cell cycle progression.
Formula:C10H14N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:226.23 g/mol




