
CAS 34580-11-5
:10-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one
Description:
10-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes both benzene and thiophene moieties. The presence of a bromine atom at the 10-position enhances its reactivity and can influence its electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. This compound typically exhibits a range of physical properties, such as moderate solubility in organic solvents and potential fluorescence, depending on the specific environment and substituents. Its unique structure may also impart interesting optical and electronic characteristics, making it a candidate for use in organic electronics or as a dye. Additionally, the compound's stability and reactivity can be influenced by the presence of the bromine substituent, which may participate in further chemical reactions. Overall, 10-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one represents a fascinating subject for research in organic chemistry and materials development.
Formula:C13H7BrOS
InChI:InChI=1S/C13H7BrOS/c14-11-7-8-3-1-2-4-9(8)12(15)10-5-6-16-13(10)11/h1-7H
InChI key:InChIKey=JTYAUSWEFIWMHF-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(Br)=CC=3C1=CC=CC3)SC=C2
Synonyms:- 10-Bromo-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one
- 4H-Benzo[4,5]cyclohepta[1,2-b]thiophen-4-one, 10-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

