CAS 34581-92-5

1-acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one

Description:

1-Acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one, with the CAS number 34581-92-5, is a heterocyclic organic compound characterized by its pyrrolone structure. This compound features a five-membered ring containing both nitrogen and a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the acetyl group enhances its electrophilic character, making it useful in various chemical reactions, including acylation and condensation processes. Additionally, the methyl group at the 4-position can influence its steric and electronic properties, affecting its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in organic solvents and stability under standard conditions further contribute to its utility in laboratory and industrial applications.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c1-5-3-7(10)8(4-5)6(2)9/h3H,4H2,1-2H3

SMILES: CC1=CC(=O)N(C1)C(=O)C

Synonyms:

• 1-acetyl-4-methyl-1,5-dihydro-2H-pyrrol-2-one

1-Acetyl-1,5-dihydro-4-methyl-2H-pyrrol-2-one

CAS: 34581-92-5

1-Acetyl-1,5-dihydro-4-methyl-2H-pyrrol-2-one

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 139.15g/mol

Ref: 54-OR21809