CAS 34582-27-9: 5-Hydroxy-2-methyltyrosine

Description:5-Hydroxy-2-methyltyrosine, also known by its CAS number 34582-27-9, is a naturally occurring amino acid derivative that is structurally related to tyrosine. This compound features a hydroxyl group at the 5-position of the aromatic ring and a methyl group at the 2-position, which distinguishes it from standard tyrosine. It is characterized by its potential role in biological systems, particularly in the synthesis of neurotransmitters and other important biomolecules. The presence of the hydroxyl group enhances its reactivity and solubility in polar solvents. 5-Hydroxy-2-methyltyrosine may exhibit antioxidant properties and could be involved in various metabolic pathways. Its applications may extend to research in neurobiology and pharmacology, where it could serve as a precursor or modulator in biochemical processes. However, detailed studies on its specific biological activities and therapeutic potential are still ongoing, and further research is needed to fully elucidate its functions and applications in health and disease.

Formula:C₁₀H₁₃NO₄

InChI:InChI=1S/C10H13NO4/c1-5-2-8(12)9(13)4-6(5)3-7(11)10(14)15/h2,4,7,12-13H,3,11H2,1H3,(H,14,15)

InChI key:InChIKey=ZQCYJCMADFAKAA-UHFFFAOYSA-N

SMILES:O=C(O)C(N)CC1=CC(O)=C(O)C=C1C