
CAS 34586-50-0
:3-Ethylbenzenesulfonyl fluoride
Description:
3-Ethylbenzenesulfonyl fluoride, with the CAS number 34586-50-0, is an organic compound characterized by the presence of a sulfonyl fluoride functional group attached to a benzene ring that has an ethyl substituent in the meta position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly due to the sulfonyl fluoride group, which can act as a potent electrophile in various chemical reactions, making it useful in synthetic organic chemistry. The compound is often employed as a reagent in the preparation of sulfonamides and other sulfonyl derivatives. Additionally, it may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its solubility in organic solvents and limited solubility in water further define its chemical behavior in different environments. Overall, 3-Ethylbenzenesulfonyl fluoride is a valuable compound in the field of chemical synthesis and research.
Formula:C8H9FO2S
InChI:InChI=1S/C8H9FO2S/c1-2-7-4-3-5-8(6-7)12(9,10)11/h3-6H,2H2,1H3
InChI key:InChIKey=ONMDVARUZGDUIW-UHFFFAOYSA-N
SMILES:S(F)(=O)(=O)C1=CC(CC)=CC=C1
Synonyms:- m-Ethylbenzenesulfonyl fluoride
- m-Ethylphenylsulfonyl fluoride
- 3-Ethylbenzene-1-sulfonyl fluoride
- Benzenesulfonyl fluoride, 3-ethyl-
- 3-Ethylbenzenesulfonyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenesulfonyl fluoride, 3-ethyl-
CAS:Benzenesulfonyl fluoride, 3-ethyl- is a bioactive chemical.Formula:C8H9FO2SColor and Shape:SolidMolecular weight:188.22
