CAS 34589-46-3: bromo-(2,4-dimethylphenyl)magnesium

Description:Bromo-(2,4-dimethylphenyl)magnesium, with the CAS number 34589-46-3, is an organomagnesium compound that belongs to the class of Grignard reagents. These reagents are characterized by their highly reactive nature, particularly towards electrophiles, due to the presence of a carbon-magnesium bond. This specific compound features a bromo-substituted aromatic ring, which enhances its reactivity and makes it useful in various organic synthesis applications. The presence of the dimethyl groups on the aromatic ring can influence the steric and electronic properties of the molecule, potentially affecting its reactivity and the types of reactions it can undergo. Grignard reagents like this one are typically prepared by reacting an alkyl or aryl halide with magnesium metal in an anhydrous ether solvent. They are commonly used in nucleophilic addition reactions, allowing for the formation of carbon-carbon bonds, which is essential in the synthesis of complex organic molecules. However, due to their reactivity, they must be handled with care, as they can react violently with water and other protic solvents.

Formula:C₈H₉BrMg

InChI:InChI=1/C8H9.BrH.Mg/c1-7-4-3-5-8(2)6-7;;/h3-4,6H,1-2H3;1H;/q;;+1/p-1/rC8H9BrMg/c1-6-3-4-8(10-9)7(2)5-6/h3-5H,1-2H3

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2,4-Dimethylphenylmagnesium bromide, 0.5M THF REF: 10-F214143CAS: 34589-46-3	97.0%	- - -	Discontinued product
	2,4-Dimethylphenylmagnesium bromide REF: 3D-JBA58946CAS: 34589-46-3	Min. 95%	- - -	Discontinued product