CAS 345909-96-8

1-(trideuteriomethyl)-2H-tetrazole-5-thione

Description:

1-(Trideuteriomethyl)-2H-tetrazole-5-thione is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a thione functional group. The presence of trideuteriomethyl indicates that the compound contains three deuterium atoms, which are isotopes of hydrogen, replacing standard hydrogen atoms in the methyl group. This substitution can significantly affect the compound's physical and chemical properties, such as its mass and isotopic behavior in reactions. The tetrazole ring is known for its stability and ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry and materials science. The thione group contributes to the compound's reactivity, particularly in nucleophilic and electrophilic reactions. Overall, this compound is of interest in research fields that explore isotopic labeling, drug development, and the synthesis of novel materials. Its specific applications and behavior would depend on the context of its use in research or industry.

Formula: C₂HD₃N₄S

InChI: InChI=1/C2H4N4S/c1-6-2(7)3-4-5-6/h1H3,(H,3,5,7)/i1D3

SMILES: C(n1c(nnn1)S)([2H])([2H])[2H]

Synonyms:

• 1-(< sup> 2< /sup> H< sub> 3< /sub> )Methyl-1H-tetrazole-5-thiol
• 1H-tetrazole-5-thiol, 1-(methyl-d< sub> 3< /sub> )-

1-Methyl-d3-5-mercapto-1,2,3,4-tetrazole

CAS: 345909-96-8

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 119.16

Ref: 3U-D2797

N-Methyl-5-tetrazolethiol-d3

Controlled Product

CAS: 345909-96-8

Applications A labelled impurity of Cefoperazone.
References Kitson, T., et al.: Biochem. J., 175, 83 (1978), Elenbaas, R., et al.: Clin. Pharmacol. Ther., 32, 347 (1982),

Formula: C₂HD₃N₄S

Color and Shape: Neat

Molecular weight: 119.16

Ref: TR-M330262