CAS 345954-00-9
:Wilfornine A
Description:
Wilfornine A, with the CAS number 345954-00-9, is a natural product derived from the plant species Wilfordia ebracteata, which is known for its traditional medicinal uses. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Wilfornine A exhibits notable pharmacological properties, including potential anti-inflammatory and anticancer effects, making it a subject of interest in medicinal chemistry and drug development. Its mechanism of action may involve the modulation of various signaling pathways, although detailed studies are ongoing to elucidate its specific interactions at the molecular level. Additionally, the compound's solubility, stability, and reactivity are influenced by its structural features, which are critical for its bioavailability and therapeutic efficacy. As research continues, Wilfornine A may offer insights into new therapeutic strategies and contribute to the development of novel pharmaceuticals.
Formula:C45H51NO20
InChI:InChI=1S/C45H51NO20/c1-22(47)57-21-44-36(62-26(5)51)32(59-23(2)48)31-34(61-25(4)50)45(44)43(9,56)35(33(60-24(3)49)37(44)63-27(6)52)64-40(55)41(7,65-38(53)28-14-11-10-12-15-28)18-17-30-29(16-13-19-46-30)39(54)58-20-42(31,8)66-45/h10-16,19,31-37,56H,17-18,20-21H2,1-9H3/t31-,32-,33+,34-,35+,36-,37+,41?,42+,43+,44-,45+/m1/s1
InChI key:InChIKey=YJDNHPICMWQYIV-UJSRMDARSA-N
SMILES:C(OC(C)=O)[C@]12[C@@]34[C@H](OC(C)=O)[C@]([C@@](C)(O3)COC(=O)C=5C(CCC(OC(=O)C6=CC=CC=C6)(C)C(=O)O[C@]([C@]4(C)O)([C@H](OC(C)=O)[C@@H]1OC(C)=O)[H])=NC=CC5)([C@@H](OC(C)=O)[C@H]2OC(C)=O)[H]
Synonyms:- Wilfornine A
- 8,11-Epoxy-9,12-ethano-11,15-methano-5H,11H-[1,9]dioxacyclooctadecino[4,3-b]pyridine-5,17(18H)-dione, 10,13,14,22,23-pentakis(acetyloxy)-12-[(acetyloxy)methyl]-18-(benzoyloxy)-7,8,9,10,12,13,14,15,19,20-decahydro-21-hydroxy-8,18,21-trimethyl-, (8R,9R,10R,11S,12R,13R,14R,15S,21S,22S,23R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Wilfornine A
CAS:Wilfornine A is a natural product from Schisandra sphenanthera.Formula:C45H51NO20Purity:98%Color and Shape:SolidMolecular weight:925.89Wilfornine A
CAS:<p>Wilfornine A is an alkaloid compound derived from the roots of the plant Tripterygium wilfordii, traditionally known for its potent medicinal properties. This compound exhibits its mechanism of action primarily through the modulation of the immune system, characterized by its ability to inhibit the activation and proliferation of T-cells. The suppression of these immune responses is largely attributed to the disruption of interleukin-2 production and interference in the NF-kB signaling pathway, which plays a crucial role in immune regulation.</p>Formula:C45H51NO20Purity:Min. 95%Molecular weight:925.89 g/mol


