CymitQuimica logo

CAS 34596-36-6

:

Benzene, 1,4-bis(2-propynyloxy)-

Description:
Benzene, 1,4-bis(2-propynyloxy)-, also known by its CAS number 34596-36-6, is an organic compound characterized by a benzene ring substituted with two propynyloxy groups at the 1 and 4 positions. This compound features a linear alkyne structure due to the presence of the propynyl groups, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ether linkages (propynyloxy) enhances its solubility in organic solvents and may influence its physical properties, such as boiling and melting points. Benzene derivatives are known for their stability due to resonance, but the introduction of alkynes can impart unique chemical behavior, including the potential for further reactions such as polymerization or coupling reactions. This compound may be of interest in materials science, particularly in the development of functionalized polymers or as intermediates in organic synthesis. Safety considerations should be taken into account, as benzene derivatives can be toxic and potentially carcinogenic.
Formula:C12H10O2
InChI:InChI=1S/C12H10O2/c1-3-9-13-11-5-7-12(8-6-11)14-10-4-2/h1-2,5-8H,9-10H2
InChI key:ODCQCPUUPWRQKV-UHFFFAOYSA-N
SMILES:C#CCOC1=CC=C(C=C1)OCC#C
Found 5 products.