CAS 345985-65-1

4-[(2-Chlorophenyl)methoxy]-3-ethoxy-5-iodobenzaldehyde

Description:

4-[(2-Chlorophenyl)methoxy]-3-ethoxy-5-iodobenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group, an ether linkage, and halogen substituents. The presence of the iodo group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The chlorophenyl moiety contributes to its aromatic character and may influence its electronic properties, while the ethoxy group can affect solubility and reactivity. This compound is likely to be a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the synthesis of biologically active molecules or as intermediates in organic synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks. As with any chemical, proper characterization through techniques such as NMR, IR, and mass spectrometry is essential for confirming its identity and purity.

Formula: C₁₆H₁₄ClIO₃

InChI: InChI=1S/C16H14ClIO3/c1-2-20-15-8-11(9-19)7-14(18)16(15)21-10-12-5-3-4-6-13(12)17/h3-9H,2,10H2,1H3

InChI key: InChIKey=RTMNFFXXTGHIJF-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC2=C(Cl)C=CC=C2)C(I)=CC(C=O)=C1

Synonyms:

• 4-[(2-Chlorophenyl)methoxy]-3-ethoxy-5-iodobenzaldehyde
• Benzaldehyde, 4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodo-

4-[(2-Chlorobenzyl)oxy]-3-ethoxy-5-iodobenzaldehyde

CAS: 345985-65-1

Versatile small molecule scaffold

Formula: C₁₆H₁₄ClIO₃

Purity: Min. 95%

Molecular weight: 416.64 g/mol

Ref: 3D-VNA98565