CAS 3460-04-6

Propanamide, 3-chloro-N-phenyl-

Description:

Propanamide, 3-chloro-N-phenyl- is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the 3-position of the propanamide structure contributes to its reactivity and potential applications in various chemical reactions. The N-phenyl substituent indicates that a phenyl group is attached to the nitrogen atom of the amide, which can influence the compound's solubility, stability, and biological activity. This compound may exhibit properties typical of amides, such as moderate polarity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. Additionally, the chlorine atom can impart unique electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Propanamide, 3-chloro-N-phenyl- may be of interest in pharmaceutical research and synthesis, as well as in the development of agrochemicals or other industrial applications. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₉H₁₀ClNO

InChI: InChI=1/C9H10ClNO/c10-7-6-9(12)11-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)

SMILES: c1ccc(cc1)N=C(CCCl)O

Synonyms:

• 3-Chloro-N-phenylpropanamide
• 3-Chloro-N-phenylpropionamide

3-Chloro-N-phenylpropanamide

CAS: 3460-04-6

Formula: C₉H₁₀ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.6348

Ref: IN-DA00BZS6

3-Chloro-N-phenylpropanamide

CAS: 3460-04-6

3-Chloro-N-phenylpropanamide

Purity: 97%

Molecular weight: 183.63g/mol

Ref: 54-OR964996

3-Chloro-N-phenylpropionamide

CAS: 3460-04-6

Formula: C₉H₁₀ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.64

Ref: 10-F049246