CymitQuimica logo

CAS 34601-54-2

:

1,3,6,8-Tetrakis(tert.-butyl)carbazole

Description:
1,3,6,8-Tetrakis(tert-butyl)carbazole is an organic compound characterized by its complex structure, which includes a carbazole core substituted with four tert-butyl groups at the 1, 3, 6, and 8 positions. This substitution significantly enhances its solubility in organic solvents and contributes to its thermal stability. The presence of the tert-butyl groups also imparts steric hindrance, which can influence its reactivity and interactions with other molecules. This compound is often studied for its potential applications in organic electronics, particularly in light-emitting diodes (OLEDs) and as a hole transport material due to its favorable electronic properties. Additionally, its robust structure makes it resistant to degradation, which is advantageous for long-term applications. The compound is typically handled with standard safety precautions, as with many organic chemicals, and its properties can be further explored through various analytical techniques such as NMR and mass spectrometry. Overall, 1,3,6,8-Tetrakis(tert-butyl)carbazole represents a significant interest in materials science and organic chemistry.
Formula:C28H41N
InChI:InChI=1/C28H41N/c1-25(2,3)17-13-19-20-14-18(26(4,5)6)16-22(28(10,11)12)24(20)29-23(19)21(15-17)27(7,8)9/h13-16,29H,1-12H3
InChI key:OVSGNPWPCZRNKI-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc2c3cc(cc(c3[nH]c2c(c1)C(C)(C)C)C(C)(C)C)C(C)(C)C
Synonyms:
  • 1,3,6,8-tetra-tert-butyl-9H-carbazole
Found 4 products.