CAS 34616-39-2
:Fenalcomine
Description:
Fenalcomine, identified by its CAS number 34616-39-2, is a chemical compound that belongs to the class of amines. It is characterized by its specific molecular structure, which typically includes an aromatic ring and an amine functional group. This compound is often studied for its potential applications in various fields, including pharmaceuticals and organic synthesis. Fenalcomine may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the presence of functional groups in its structure. The compound's behavior in chemical reactions, such as nucleophilic substitution or electrophilic aromatic substitution, can be significant in synthetic chemistry. Additionally, its safety profile, including toxicity and environmental impact, should be considered when handling or utilizing this substance in research or industrial applications. As with any chemical, proper safety protocols and guidelines should be followed to ensure safe usage.
Formula:C20H27NO2
InChI:InChI=1S/C20H27NO2/c1-3-20(22)18-9-11-19(12-10-18)23-14-13-21-16(2)15-17-7-5-4-6-8-17/h4-12,16,20-22H,3,13-15H2,1-2H3
InChI key:InChIKey=DOBLSWXRNYSVDC-UHFFFAOYSA-N
SMILES:C(CC)(O)C1=CC=C(OCCNC(CC2=CC=CC=C2)C)C=C1
Synonyms:- dl-N-[β-[p-(1-Hydroxypropyl)phenoxy]ethyl]-1-phenyl-2-aminopropane
- Fenalcomine
- Benzenemethanol, α-ethyl-4-[2-[(1-methyl-2-phenylethyl)amino]ethoxy]-
- α-Ethyl-4-[2-[(1-methyl-2-phenylethyl)amino]ethoxy]benzenemethanol
- α-Ethyl-p-[2-[(α-methylphenethyl)amino]ethoxy]benzyl alcohol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fenalcomine
CAS:<p>Fenalcomine inhibits the action of prostaglandins on smooth muscle but stimulates TXA2.</p>Formula:C20H27NO2Color and Shape:SolidMolecular weight:313.43
