CAS 34622-39-4
:(S)-Piperidinone-6-carboxylic acid
Description:
(S)-Piperidinone-6-carboxylic acid, with the CAS number 34622-39-4, is a chiral compound characterized by its piperidinone structure, which includes a six-membered ring containing nitrogen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the chiral center allows for the existence of enantiomers, with the (S)-configuration indicating a specific spatial arrangement of atoms that can influence its biological activity and interactions. Typically, compounds like (S)-Piperidinone-6-carboxylic acid are of interest in medicinal chemistry and pharmaceutical applications due to their potential as intermediates in the synthesis of various bioactive molecules. The compound is soluble in polar solvents, which is common for carboxylic acids, and its properties can be influenced by factors such as pH and temperature. Overall, (S)-Piperidinone-6-carboxylic acid serves as a valuable building block in organic synthesis and may exhibit specific pharmacological effects, warranting further investigation in drug development.
Formula:C6H9NO3
InChI:InChI=1/C6H9NO3/c8-5-3-1-2-4(7-5)6(9)10/h4H,1-3H2,(H,7,8)(H,9,10)/t4-/m0/s1
SMILES:C1C[C@@H](C(=O)O)N=C(C1)O
Synonyms:- L-Pyrohomoglutamic Acid
- L-6-Oxo-Pipecolinic Acid
- H-L-Pon-Oh
- 6-Oxo-L-Pipecolic Acid
- (S)-2-Piperidinone-6-Carboxylic Acid
- (S)-2-Piperidone-6-Carboxylic Acid
- (S)-6-Oxo-2-Piperidinecarboxylic Acid
- (S)-6-Oxo-Piperidine-2-Carboxylic Acid
- (2S)-6-oxopiperidine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-Piperidinone-6-carboxylic acid
CAS:Formula:C6H9NO3Purity:97%Color and Shape:SolidMolecular weight:143.1406Ref: IN-DA003CLA
1g56.00€5g138.00€10g195.00€25g644.00€50gTo inquire100gTo inquire250gTo inquire100mg24.00€250mg25.00€L-Pyrohomoglutamic Acid
CAS:L-Pyrohomoglutamic acid, an amino acid, aids in synthesizing FKBP ligands and HDAC inhibitors.Formula:C6H9NO3Color and Shape:SolidMolecular weight:143.14(2S)-6-Oxopiperidine-2-carboxylic acid
CAS:(2S)-6-Oxopiperidine-2-carboxylic acidPurity:99%Molecular weight:143.14g/mol6-Oxo-L-pipecolic Acid
CAS:Controlled ProductApplications 6-Oxo-L-pipecolic Acid is an intermediate in the synthesis of metabolites of lysine developed during aging and in diabetic patients.
References Bartolozzi, A., et al.: Bioorg. Med. Chem. Lett., 25, 587 (2015); Giannini, G., et al.: J. Med. Chem., 57, 8358 (2014);Formula:C6H9NO3Color and Shape:NeatMolecular weight:143.14




