CAS 3463-26-1
:1-methyl-3-phenyl-1H-pyrazole
Description:
1-Methyl-3-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl group at the 1-position and a phenyl group at the 3-position of the pyrazole ring, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, and its molecular formula reflects the presence of carbon, hydrogen, and nitrogen atoms. The compound exhibits moderate solubility in organic solvents, which is common for pyrazole derivatives. 1-Methyl-3-phenyl-1H-pyrazole is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities. Its reactivity can be influenced by the substituents on the pyrazole ring, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H10N2
InChI:InChI=1/C10H10N2/c1-12-8-7-10(11-12)9-5-3-2-4-6-9/h2-8H,1H3
SMILES:Cn1ccc(c2ccccc2)n1
Synonyms:- 1H-pyrazole, 1-methyl-3-phenyl-
- 1-Methyl-3-phenylpyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Methyl-3-phenyl-1H-pyrazole
CAS:Formula:C10H10N2Purity:97%Color and Shape:SolidMolecular weight:158.19981-methyl-3-phenyl-1H-pyrazole
CAS:Formula:C10H10N2Purity:97%Color and Shape:SolidMolecular weight:158.2041-Methyl-3-phenyl-1H-pyrazole
CAS:Controlled Product<p>Applications 1-methyl-3-phenyl-1H-pyrazole is a useful research reagent for the synthesis of bioactive important small molecules.<br>References Blum, L. C., et al.: J. Chem. Inf. Model., 51, 3105 (2011); Koronatov, A. N., et al.: J. Org. Chem., 83, 210 (2018)<br></p>Formula:C10H10N2Color and Shape:NeatMolecular weight:158.21-Methyl-3-phenyl-1H-pyrazole
CAS:<p>1-Methyl-3-phenyl-1H-pyrazole is an agriculturally useful compound that can be used as an intermediate in the synthesis of pesticides. 1-Methyl-3-phenyl-1H-pyrazole has two different orientations with respect to the pyrazole ring, which gives rise to two isomers. The cis form is a photoelectron acceptor and the trans form is a photoelectron donor. The molecular orbitals of 1-methyl-3-phenylpyrazole are energetically similar to those of other pyrazoles. The difference lies in the orientation of the nitrogen atom, which makes it unsymmetrical. It also has a sulfate group and a dihedral angle of 60°. 1,2,4,5,6-Pentafluoroalkyl and pyrazolyl groups have been found on this molecule.</p>Formula:C10H10N2Purity:Min. 95%Molecular weight:158.2 g/mol




